About N-benzhydrylmethanimine
N-benzhydrylmethanimine (PubChem CID 164737969) has the molecular formula C14H12N-
and a molecular weight of 194.26 g/mol. Its IUPAC name is N-benzhydrylmethanimine.
Molecular Properties
| Compound Name | N-benzhydrylmethanimine |
| PubChem CID | 164737969 |
| Molecular Formula | C14H12N- |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | N-benzhydrylmethanimine |
| SMILES | [H]/[C-]=N/C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h1-11,14H/q-1 |
| InChIKey | HLLQFHFXMHOCBF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzhydrylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydrylmethanimine?
The IUPAC name of N-benzhydrylmethanimine (CID 164737969) is N-benzhydrylmethanimine.
What is the SMILES notation for N-benzhydrylmethanimine?
The canonical SMILES for N-benzhydrylmethanimine is [H]/[C-]=N/C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-benzhydrylmethanimine?
The InChIKey is HLLQFHFXMHOCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h1-11,14H/q-1.
What are the key properties of N-benzhydrylmethanimine?
N-benzhydrylmethanimine has a molecular weight of 194.26 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydrylmethanimine is sourced from PubChem (CID 164737969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).