About benzhydrylalumane
benzhydrylalumane (PubChem CID 146889225) has the molecular formula C13H13Al
and a molecular weight of 196.23 g/mol. Its IUPAC name is benzhydrylalumane.
Molecular Properties
| Compound Name | benzhydrylalumane |
| PubChem CID | 146889225 |
| Molecular Formula | C13H13Al |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | benzhydrylalumane |
| SMILES | [AlH2]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11.Al.2H/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;;/h1-11H;;; |
| InChIKey | SYTZKVSOCKZJSB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzhydrylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylalumane?
The IUPAC name of benzhydrylalumane (CID 146889225) is benzhydrylalumane.
What is the SMILES notation for benzhydrylalumane?
The canonical SMILES for benzhydrylalumane is [AlH2]C(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydrylalumane?
The InChIKey is SYTZKVSOCKZJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11.Al.2H/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;;/h1-11H;;;.
What are the key properties of benzhydrylalumane?
benzhydrylalumane has a molecular weight of 196.23 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylalumane is sourced from PubChem (CID 146889225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).