About diazenyl(phenyl)methanol
diazenyl(phenyl)methanol (PubChem CID 173253915) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is diazenyl(phenyl)methanol.
Molecular Properties
| Compound Name | diazenyl(phenyl)methanol |
| PubChem CID | 173253915 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | diazenyl(phenyl)methanol |
| SMILES | [H]/N=N/C(O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5,7-8,10H/b9-8+ |
| InChIKey | XMNZBPXUHDSUBH-CMDGGOBGSA-N |
| XLogP | 1.71 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze diazenyl(phenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazenyl(phenyl)methanol?
The IUPAC name of diazenyl(phenyl)methanol (CID 173253915) is diazenyl(phenyl)methanol.
What is the SMILES notation for diazenyl(phenyl)methanol?
The canonical SMILES for diazenyl(phenyl)methanol is [H]/N=N/C(O)c1ccccc1.
What is the InChIKey of diazenyl(phenyl)methanol?
The InChIKey is XMNZBPXUHDSUBH-CMDGGOBGSA-N. The full InChI is InChI=1S/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5,7-8,10H/b9-8+.
What are the key properties of diazenyl(phenyl)methanol?
diazenyl(phenyl)methanol has a molecular weight of 136.15 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazenyl(phenyl)methanol is sourced from PubChem (CID 173253915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).