C21H19NO2 — CID 145235495
[4-(1,2-diphenylethyl)phenyl]-nitrosomethanol (PubChem CID 145235495) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is [4-(1,2-diphenylethyl)phenyl]-nitrosomethanol.
| Compound Name | [4-(1,2-diphenylethyl)phenyl]-nitrosomethanol |
|---|---|
| PubChem CID | 145235495 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [4-(1,2-diphenylethyl)phenyl]-nitrosomethanol |
| SMILES | O=NC(O)c1ccc(C(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO2/c23-21(22-24)19-13-11-18(12-14-19)20(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h1-14,20-21,23H,15H2 |
| InChIKey | LXLIISMGXNUQSI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |