C12H12BrNO2 — CID 54424617
2-(6-bromo-5-methoxy-1H-inden-1-yl)acetamide (PubChem CID 54424617) has the molecular formula C12H12BrNO2 and a molecular weight of 282.14 g/mol. Its IUPAC name is 2-(6-bromo-5-methoxy-1H-inden-1-yl)acetamide.
| Compound Name | 2-(6-bromo-5-methoxy-1H-inden-1-yl)acetamide |
|---|---|
| PubChem CID | 54424617 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-(6-bromo-5-methoxy-1H-inden-1-yl)acetamide |
| SMILES | COc1cc2c(cc1Br)C(CC(N)=O)C=C2 |
| InChI | InChI=1S/C12H12BrNO2/c1-16-11-4-7-2-3-8(5-12(14)15)9(7)6-10(11)13/h2-4,6,8H,5H2,1H3,(H2,14,15) |
| InChIKey | WDEXXCHOXZFYEB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |