C10H12O6S — CID 54425861
1,1,2-trihydroxy-2-phenylbut-3-ene-1-sulfonic acid (PubChem CID 54425861) has the molecular formula C10H12O6S and a molecular weight of 260.27 g/mol. Its IUPAC name is 1,1,2-trihydroxy-2-phenylbut-3-ene-1-sulfonic acid.
| Compound Name | 1,1,2-trihydroxy-2-phenylbut-3-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 54425861 |
| Molecular Formula | C10H12O6S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1,1,2-trihydroxy-2-phenylbut-3-ene-1-sulfonic acid |
| SMILES | C=CC(O)(c1ccccc1)C(O)(O)S(=O)(=O)O |
| InChI | InChI=1S/C10H12O6S/c1-2-9(11,8-6-4-3-5-7-8)10(12,13)17(14,15)16/h2-7,11-13H,1H2,(H,14,15,16) |
| InChIKey | WEAJKLIAQXASSQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|