methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate

C18H19NO5 — CID 54427745

IUPACmethyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate
SMILESCOC(=O)CCCC(N=O)C(=O)c1ccc2cc(OC)ccc2c1
InChIInChI=1S/C18H19NO5/c1-23-15-9-8-12-10-14(7-6-13(12)11-15)18(21)16(19-22)4-3-5-17(20)24-2/h6-11,16H,3-5H2,1-2H3
InChIKeyWFHUDDODUSQPFN-UHFFFAOYSA-N
MW329.35 g/mol
LogP3.51
Rot. Bonds8

About methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate

methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate (PubChem CID 54427745) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate.

Molecular Properties

Compound Namemethyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate
PubChem CID54427745
Molecular FormulaC18H19NO5
Molecular Weight329.35 g/mol
Exact Mass329.13
IUPAC Namemethyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate
SMILESCOC(=O)CCCC(N=O)C(=O)c1ccc2cc(OC)ccc2c1
InChIInChI=1S/C18H19NO5/c1-23-15-9-8-12-10-14(7-6-13(12)11-15)18(21)16(19-22)4-3-5-17(20)24-2/h6-11,16H,3-5H2,1-2H3
InChIKeyWFHUDDODUSQPFN-UHFFFAOYSA-N
XLogP3.51
TPSA82.03 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.35
LogP ≤ 53.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate?
The IUPAC name of methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate (CID 54427745) is methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate.
What is the SMILES notation for methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate?
The canonical SMILES for methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate is COC(=O)CCCC(N=O)C(=O)c1ccc2cc(OC)ccc2c1.
What is the InChIKey of methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate?
The InChIKey is WFHUDDODUSQPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c1-23-15-9-8-12-10-14(7-6-13(12)11-15)18(21)16(19-22)4-3-5-17(20)24-2/h6-11,16H,3-5H2,1-2H3.
What are the key properties of methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate?
methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate has a molecular weight of 329.35 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(6-methoxynaphthalen-2-yl)-5-nitroso-6-oxohexanoate is sourced from PubChem (CID 54427745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).