C26H31N7O2 — CID 54429961
(2S)-1-[[1-hexyl-5-[2-(2H-tetrazol-5-yl)phenyl]benzimidazol-2-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 54429961) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is (2S)-1-[[1-hexyl-5-[2-(2H-tetrazol-5-yl)phenyl]benzimidazol-2-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[1-hexyl-5-[2-(2H-tetrazol-5-yl)phenyl]benzimidazol-2-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54429961 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (2S)-1-[[1-hexyl-5-[2-(2H-tetrazol-5-yl)phenyl]benzimidazol-2-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCn1c(CN2CCC[C@H]2C(=O)O)nc2cc(-c3ccccc3-c3nn[nH]n3)ccc21 |
| InChI | InChI=1S/C26H31N7O2/c1-2-3-4-7-15-33-22-13-12-18(19-9-5-6-10-20(19)25-28-30-31-29-25)16-21(22)27-24(33)17-32-14-8-11-23(32)26(34)35/h5-6,9-10,12-13,16,23H,2-4,7-8,11,14-15,17H2,1H3,(H,34,35)(H,28,29,30,31)/t23-/m0/s1 |
| InChIKey | WGTZWDOQGWQQIE-QHCPKHFHSA-N |
| XLogP | 4.51 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|