C13H11IN2O5 — CID 54431260
2-[[2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetyl]amino]benzoic acid (PubChem CID 54431260) has the molecular formula C13H11IN2O5 and a molecular weight of 402.14 g/mol. Its IUPAC name is 2-[[2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetyl]amino]benzoic acid.
| Compound Name | 2-[[2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 54431260 |
| Molecular Formula | C13H11IN2O5 |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 2-[[2-(2,5-dihydroxypyrrol-1-yl)-2-iodoacetyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)C(I)n1c(O)ccc1O |
| InChI | InChI=1S/C13H11IN2O5/c14-11(16-9(17)5-6-10(16)18)12(19)15-8-4-2-1-3-7(8)13(20)21/h1-6,11,17-18H,(H,15,19)(H,20,21) |
| InChIKey | WHQFXWCPWAVCSJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|