C9H11NO4S — CID 54432178
O-(2,5-dihydroxypyrrol-1-yl) 4-oxopentanethioate (PubChem CID 54432178) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is O-(2,5-dihydroxypyrrol-1-yl) 4-oxopentanethioate.
| Compound Name | O-(2,5-dihydroxypyrrol-1-yl) 4-oxopentanethioate |
|---|---|
| PubChem CID | 54432178 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | O-(2,5-dihydroxypyrrol-1-yl) 4-oxopentanethioate |
| SMILES | CC(=O)CCC(=S)On1c(O)ccc1O |
| InChI | InChI=1S/C9H11NO4S/c1-6(11)2-5-9(15)14-10-7(12)3-4-8(10)13/h3-4,12-13H,2,5H2,1H3 |
| InChIKey | WIFSQRYEIDFWIH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|