C11H19NO2S2 — CID 54434760
ethyl (2,2,4-trimethylpyrrolidine-1-carbothioyl)sulfanylformate (PubChem CID 54434760) has the molecular formula C11H19NO2S2 and a molecular weight of 261.41 g/mol. Its IUPAC name is ethyl (2,2,4-trimethylpyrrolidine-1-carbothioyl)sulfanylformate.
| Compound Name | ethyl (2,2,4-trimethylpyrrolidine-1-carbothioyl)sulfanylformate |
|---|---|
| PubChem CID | 54434760 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | ethyl (2,2,4-trimethylpyrrolidine-1-carbothioyl)sulfanylformate |
| SMILES | CCOC(=O)SC(=S)N1CC(C)CC1(C)C |
| InChI | InChI=1S/C11H19NO2S2/c1-5-14-10(13)16-9(15)12-7-8(2)6-11(12,3)4/h8H,5-7H2,1-4H3 |
| InChIKey | WJYOAGRVDNGGQQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|