C19H22N2O — CID 54436062
4-[(3S)-3-[(2S)-2-phenylaziridin-1-yl]butyl]benzamide (PubChem CID 54436062) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-[(3S)-3-[(2S)-2-phenylaziridin-1-yl]butyl]benzamide.
| Compound Name | 4-[(3S)-3-[(2S)-2-phenylaziridin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 54436062 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-[(3S)-3-[(2S)-2-phenylaziridin-1-yl]butyl]benzamide |
| SMILES | C[C@@H](CCc1ccc(C(N)=O)cc1)N1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-14(21-13-18(21)16-5-3-2-4-6-16)7-8-15-9-11-17(12-10-15)19(20)22/h2-6,9-12,14,18H,7-8,13H2,1H3,(H2,20,22)/t14-,18+,21?/m0/s1 |
| InChIKey | WKUCZAMEOKOYJI-DFZPUUJXSA-N |
| XLogP | 3.16 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|