About 3-iodoprop-1-enyl N-butylcarbamate
3-iodoprop-1-enyl N-butylcarbamate (PubChem CID 54438518) has the molecular formula C8H14INO2
and a molecular weight of 283.11 g/mol. Its IUPAC name is 3-iodoprop-1-enyl N-butylcarbamate.
Molecular Properties
| Compound Name | 3-iodoprop-1-enyl N-butylcarbamate |
| PubChem CID | 54438518 |
| Molecular Formula | C8H14INO2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-iodoprop-1-enyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC=CCI |
| InChI | InChI=1S/C8H14INO2/c1-2-3-6-10-8(11)12-7-4-5-9/h4,7H,2-3,5-6H2,1H3,(H,10,11) |
| InChIKey | WMKZAKWDJDKLIW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoprop-1-enyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoprop-1-enyl N-butylcarbamate?
The IUPAC name of 3-iodoprop-1-enyl N-butylcarbamate (CID 54438518) is 3-iodoprop-1-enyl N-butylcarbamate.
What is the SMILES notation for 3-iodoprop-1-enyl N-butylcarbamate?
The canonical SMILES for 3-iodoprop-1-enyl N-butylcarbamate is CCCCNC(=O)OC=CCI.
What is the InChIKey of 3-iodoprop-1-enyl N-butylcarbamate?
The InChIKey is WMKZAKWDJDKLIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14INO2/c1-2-3-6-10-8(11)12-7-4-5-9/h4,7H,2-3,5-6H2,1H3,(H,10,11).
What are the key properties of 3-iodoprop-1-enyl N-butylcarbamate?
3-iodoprop-1-enyl N-butylcarbamate has a molecular weight of 283.11 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoprop-1-enyl N-butylcarbamate is sourced from PubChem (CID 54438518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).