C15H10ClNOS — CID 54438659
5-(2-chlorophenyl)-4-phenyl-3H-1,3-oxazole-2-thione (PubChem CID 54438659) has the molecular formula C15H10ClNOS and a molecular weight of 287.77 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-4-phenyl-3H-1,3-oxazole-2-thione.
| Compound Name | 5-(2-chlorophenyl)-4-phenyl-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 54438659 |
| Molecular Formula | C15H10ClNOS |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 5-(2-chlorophenyl)-4-phenyl-3H-1,3-oxazole-2-thione |
| SMILES | S=c1[nH]c(-c2ccccc2)c(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C15H10ClNOS/c16-12-9-5-4-8-11(12)14-13(17-15(19)18-14)10-6-2-1-3-7-10/h1-9H,(H,17,19) |
| InChIKey | WMNJYHNTGOBLOJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|