C15H11NOS — CID 853676
4,5-diphenyl-3H-1,3-oxazole-2-thione (PubChem CID 853676) has the molecular formula C15H11NOS and a molecular weight of 253.33 g/mol. Its IUPAC name is 4,5-diphenyl-3H-1,3-oxazole-2-thione.
| Compound Name | 4,5-diphenyl-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 853676 |
| Molecular Formula | C15H11NOS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 4,5-diphenyl-3H-1,3-oxazole-2-thione |
| SMILES | S=c1[nH]c(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) |
| InChIKey | NYQSTRUSYDZNHC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|