C20H17ClN4O — CID 54440462
1-(8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-N-methoxymethanimine (PubChem CID 54440462) has the molecular formula C20H17ClN4O and a molecular weight of 364.84 g/mol. Its IUPAC name is 1-(8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-N-methoxymethanimine.
| Compound Name | 1-(8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 54440462 |
| Molecular Formula | C20H17ClN4O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-(8-chloro-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl)-N-methoxymethanimine |
| SMILES | CON=Cc1nc(C)n2c1CN=C(c1ccccc1)c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C20H17ClN4O/c1-13-24-17(11-23-26-2)19-12-22-20(14-6-4-3-5-7-14)16-10-15(21)8-9-18(16)25(13)19/h3-11H,12H2,1-2H3 |
| InChIKey | WNSUEDRESYZGMP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|