C9H10N2O — CID 54440854
2-(4,5-dihydro-3H-pyrazol-3-yl)phenol (PubChem CID 54440854) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-(4,5-dihydro-3H-pyrazol-3-yl)phenol.
| Compound Name | 2-(4,5-dihydro-3H-pyrazol-3-yl)phenol |
|---|---|
| PubChem CID | 54440854 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-(4,5-dihydro-3H-pyrazol-3-yl)phenol |
| SMILES | Oc1ccccc1C1CCN=N1 |
| InChI | InChI=1S/C9H10N2O/c12-9-4-2-1-3-7(9)8-5-6-10-11-8/h1-4,8,12H,5-6H2 |
| InChIKey | WNZGMNSNNKFGNJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|