C20H14N4O2 — CID 54441912
7-oxo-N-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-13-carboxamide (PubChem CID 54441912) has the molecular formula C20H14N4O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 7-oxo-N-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-13-carboxamide.
| Compound Name | 7-oxo-N-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-13-carboxamide |
|---|---|
| PubChem CID | 54441912 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 7-oxo-N-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-13-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc2c(c1)Cc1c-2[nH]c(=O)c2nccn12 |
| InChI | InChI=1S/C20H14N4O2/c25-19(22-14-4-2-1-3-5-14)12-6-7-15-13(10-12)11-16-17(15)23-20(26)18-21-8-9-24(16)18/h1-10H,11H2,(H,22,25)(H,23,26) |
| InChIKey | WOSGLGWIWQSIKF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |