C22H35NO4 — CID 54443513
2-[[3-(dibutylamino)phenyl]methoxycarbonyl]-2-ethylbutanoic acid (PubChem CID 54443513) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[[3-(dibutylamino)phenyl]methoxycarbonyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[3-(dibutylamino)phenyl]methoxycarbonyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 54443513 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 2-[[3-(dibutylamino)phenyl]methoxycarbonyl]-2-ethylbutanoic acid |
| SMILES | CCCCN(CCCC)c1cccc(COC(=O)C(CC)(CC)C(=O)O)c1 |
| InChI | InChI=1S/C22H35NO4/c1-5-9-14-23(15-10-6-2)19-13-11-12-18(16-19)17-27-21(26)22(7-3,8-4)20(24)25/h11-13,16H,5-10,14-15,17H2,1-4H3,(H,24,25) |
| InChIKey | WPUXBZRDYBSURY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|