C18H30N2O4 — CID 54444274
3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-methylidenehexanoic acid (PubChem CID 54444274) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-methylidenehexanoic acid.
| Compound Name | 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-methylidenehexanoic acid |
|---|---|
| PubChem CID | 54444274 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3-[[1-(cyclopropylamino)-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl]-5-methyl-2-methylidenehexanoic acid |
| SMILES | C=C(C(=O)O)C(CC(C)C)C(=O)NC(C(=O)NC1CC1)C(C)(C)C |
| InChI | InChI=1S/C18H30N2O4/c1-10(2)9-13(11(3)17(23)24)15(21)20-14(18(4,5)6)16(22)19-12-7-8-12/h10,12-14H,3,7-9H2,1-2,4-6H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | WQJOABJXMLYUEO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|