C4H9Cl3N2O2S — CID 54445984
N-(3-aminopropyl)-1,1,1-trichloromethanesulfonamide (PubChem CID 54445984) has the molecular formula C4H9Cl3N2O2S and a molecular weight of 255.55 g/mol. Its IUPAC name is N-(3-aminopropyl)-1,1,1-trichloromethanesulfonamide.
| Compound Name | N-(3-aminopropyl)-1,1,1-trichloromethanesulfonamide |
|---|---|
| PubChem CID | 54445984 |
| Molecular Formula | C4H9Cl3N2O2S |
| Molecular Weight | 255.55 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | N-(3-aminopropyl)-1,1,1-trichloromethanesulfonamide |
| SMILES | NCCCNS(=O)(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H9Cl3N2O2S/c5-4(6,7)12(10,11)9-3-1-2-8/h9H,1-3,8H2 |
| InChIKey | WRNRYYXHPJJZCM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.55 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|