C11H21N3 — CID 54446376
3,5-dibutyl-1-methyl-1,2,4-triazole (PubChem CID 54446376) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 3,5-dibutyl-1-methyl-1,2,4-triazole.
| Compound Name | 3,5-dibutyl-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 54446376 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 3,5-dibutyl-1-methyl-1,2,4-triazole |
| SMILES | CCCCc1nc(CCCC)n(C)n1 |
| InChI | InChI=1S/C11H21N3/c1-4-6-8-10-12-11(9-7-5-2)14(3)13-10/h4-9H2,1-3H3 |
| InChIKey | WRUUAZZGATWYIT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |