About cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane
cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane (PubChem CID 54446759) has the molecular formula C14H26OS
and a molecular weight of 242.43 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane |
| PubChem CID | 54446759 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane |
| SMILES | C1=CCC=C1.CCSC[C@@](C)(CC)COC |
| InChI | InChI=1S/C9H20OS.C5H6/c1-5-9(3,7-10-4)8-11-6-2;1-2-4-5-3-1/h5-8H2,1-4H3;1-4H,5H2/t9-;/m0./s1 |
| InChIKey | WSBDFWDXKJSVBM-FVGYRXGTSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane?
The IUPAC name of cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane (CID 54446759) is cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane.
What is the SMILES notation for cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane?
The canonical SMILES for cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane is C1=CCC=C1.CCSC[C@@](C)(CC)COC.
What is the InChIKey of cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane?
The InChIKey is WSBDFWDXKJSVBM-FVGYRXGTSA-N. The full InChI is InChI=1S/C9H20OS.C5H6/c1-5-9(3,7-10-4)8-11-6-2;1-2-4-5-3-1/h5-8H2,1-4H3;1-4H,5H2/t9-;/m0./s1.
What are the key properties of cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane?
cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane has a molecular weight of 242.43 g/mol, XLogP of 4.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;(2S)-1-ethylsulfanyl-2-(methoxymethyl)-2-methylbutane is sourced from PubChem (CID 54446759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).