C13H24OS — CID 142377219
(2E,4E)-2-(2-methoxyethylsulfanyl)-5,6,6-trimethylhepta-2,4-diene (PubChem CID 142377219) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is (2E,4E)-2-(2-methoxyethylsulfanyl)-5,6,6-trimethylhepta-2,4-diene.
| Compound Name | (2E,4E)-2-(2-methoxyethylsulfanyl)-5,6,6-trimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 142377219 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2E,4E)-2-(2-methoxyethylsulfanyl)-5,6,6-trimethylhepta-2,4-diene |
| SMILES | COCCS/C(C)=C/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C13H24OS/c1-11(13(3,4)5)7-8-12(2)15-10-9-14-6/h7-8H,9-10H2,1-6H3/b11-7+,12-8+ |
| InChIKey | KASXLRDQLYGINP-MKICQXMISA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|