C14H27OS+ — CID 142377174
2-methoxyethyl-methyl-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]sulfanium (PubChem CID 142377174) has the molecular formula C14H27OS+ and a molecular weight of 243.44 g/mol. Its IUPAC name is 2-methoxyethyl-methyl-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]sulfanium.
| Compound Name | 2-methoxyethyl-methyl-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]sulfanium |
|---|---|
| PubChem CID | 142377174 |
| Molecular Formula | C14H27OS+ |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-methoxyethyl-methyl-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]sulfanium |
| SMILES | COCC[S+](C)/C(C)=C/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C14H27OS/c1-12(14(3,4)5)8-9-13(2)16(7)11-10-15-6/h8-9H,10-11H2,1-7H3/q+1/b12-8+,13-9+ |
| InChIKey | DOPVPRFYOSCCEZ-QHKWOANTSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|