C21H25NO — CID 54448422
2-phenyl-N-[(2,2,7-trimethylchromen-4-yl)methyl]ethanamine (PubChem CID 54448422) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-phenyl-N-[(2,2,7-trimethylchromen-4-yl)methyl]ethanamine.
| Compound Name | 2-phenyl-N-[(2,2,7-trimethylchromen-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 54448422 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-phenyl-N-[(2,2,7-trimethylchromen-4-yl)methyl]ethanamine |
| SMILES | Cc1ccc2c(c1)OC(C)(C)C=C2CNCCc1ccccc1 |
| InChI | InChI=1S/C21H25NO/c1-16-9-10-19-18(14-21(2,3)23-20(19)13-16)15-22-12-11-17-7-5-4-6-8-17/h4-10,13-14,22H,11-12,15H2,1-3H3 |
| InChIKey | WTFBYNWFXVNSAV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|