C28H28F3NO2 — CID 70572008
N-[2-[2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyethyl]-2-phenylethanamine (PubChem CID 70572008) has the molecular formula C28H28F3NO2 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[2-[2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyethyl]-2-phenylethanamine.
| Compound Name | N-[2-[2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyethyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 70572008 |
| Molecular Formula | C28H28F3NO2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[2-[2,2-dimethyl-4-[4-(trifluoromethyl)phenyl]chromen-7-yl]oxyethyl]-2-phenylethanamine |
| SMILES | CC1(C)C=C(c2ccc(C(F)(F)F)cc2)c2ccc(OCCNCCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C28H28F3NO2/c1-27(2)19-25(21-8-10-22(11-9-21)28(29,30)31)24-13-12-23(18-26(24)34-27)33-17-16-32-15-14-20-6-4-3-5-7-20/h3-13,18-19,32H,14-17H2,1-2H3 |
| InChIKey | MSVIBBMRLQMERP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|