C22H25ClF3NO2 — CID 20570516
1-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]chromen-7-yl]oxy-N,N-dimethylethanamine;hydrochloride (PubChem CID 20570516) has the molecular formula C22H25ClF3NO2 and a molecular weight of 427.89 g/mol. Its IUPAC name is 1-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]chromen-7-yl]oxy-N,N-dimethylethanamine;hydrochloride.
| Compound Name | 1-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]chromen-7-yl]oxy-N,N-dimethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 20570516 |
| Molecular Formula | C22H25ClF3NO2 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]chromen-7-yl]oxy-N,N-dimethylethanamine;hydrochloride |
| SMILES | CC(Oc1ccc2c(c1)OC(C)(C)C=C2c1cccc(C(F)(F)F)c1)N(C)C.Cl |
| InChI | InChI=1S/C22H24F3NO2.ClH/c1-14(26(4)5)27-17-9-10-18-19(13-21(2,3)28-20(18)12-17)15-7-6-8-16(11-15)22(23,24)25;/h6-14H,1-5H3;1H |
| InChIKey | LPYKPNJCIHRMBL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|