C10H14O7P2S — CID 54452416
(2-acetylsulfanyl-2-phenyl-1-phosphonoethyl)phosphonic acid (PubChem CID 54452416) has the molecular formula C10H14O7P2S and a molecular weight of 340.23 g/mol. Its IUPAC name is (2-acetylsulfanyl-2-phenyl-1-phosphonoethyl)phosphonic acid.
| Compound Name | (2-acetylsulfanyl-2-phenyl-1-phosphonoethyl)phosphonic acid |
|---|---|
| PubChem CID | 54452416 |
| Molecular Formula | C10H14O7P2S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | (2-acetylsulfanyl-2-phenyl-1-phosphonoethyl)phosphonic acid |
| SMILES | CC(=O)SC(c1ccccc1)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C10H14O7P2S/c1-7(11)20-9(8-5-3-2-4-6-8)10(18(12,13)14)19(15,16)17/h2-6,9-10H,1H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | WVVXEHJQUBKGJL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|