C17H14F4O2 — CID 54453435
2-(3-fluorobutyl)-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 54453435) has the molecular formula C17H14F4O2 and a molecular weight of 326.29 g/mol. Its IUPAC name is 2-(3-fluorobutyl)-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2-(3-fluorobutyl)-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 54453435 |
| Molecular Formula | C17H14F4O2 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(3-fluorobutyl)-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CC(F)CCc1c(C(=O)O)cccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H14F4O2/c1-9(18)5-6-12-11(3-2-4-13(12)17(22)23)10-7-14(19)16(21)15(20)8-10/h2-4,7-9H,5-6H2,1H3,(H,22,23) |
| InChIKey | WWNDTXWUSKEGGA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|