2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid

C23H26F4O2 — CID 70178502

IUPAC2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid
SMILESCCCCCCCCC(F)Cc1c(C(=O)O)cccc1-c1cc(F)c(F)c(F)c1
InChIInChI=1S/C23H26F4O2/c1-2-3-4-5-6-7-9-16(24)14-19-17(10-8-11-18(19)23(28)29)15-12-20(25)22(27)21(26)13-15/h8,10-13,16H,2-7,9,14H2,1H3,(H,28,29)
InChIKeyWUEXPMQRWCICDH-UHFFFAOYSA-N
MW410.45 g/mol
LogP7.10
Rot. Bonds11

About 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid

2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 70178502) has the molecular formula C23H26F4O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid.

Molecular Properties

Compound Name2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid
PubChem CID70178502
Molecular FormulaC23H26F4O2
Molecular Weight410.45 g/mol
Exact Mass410.19
IUPAC Name2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid
SMILESCCCCCCCCC(F)Cc1c(C(=O)O)cccc1-c1cc(F)c(F)c(F)c1
InChIInChI=1S/C23H26F4O2/c1-2-3-4-5-6-7-9-16(24)14-19-17(10-8-11-18(19)23(28)29)15-12-20(25)22(27)21(26)13-15/h8,10-13,16H,2-7,9,14H2,1H3,(H,28,29)
InChIKeyWUEXPMQRWCICDH-UHFFFAOYSA-N
XLogP7.10
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds11
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500410.45
LogP ≤ 57.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid?
The IUPAC name of 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid (CID 70178502) is 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid.
What is the SMILES notation for 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid?
The canonical SMILES for 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid is CCCCCCCCC(F)Cc1c(C(=O)O)cccc1-c1cc(F)c(F)c(F)c1.
What is the InChIKey of 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid?
The InChIKey is WUEXPMQRWCICDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26F4O2/c1-2-3-4-5-6-7-9-16(24)14-19-17(10-8-11-18(19)23(28)29)15-12-20(25)22(27)21(26)13-15/h8,10-13,16H,2-7,9,14H2,1H3,(H,28,29).
What are the key properties of 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid?
2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid has a molecular weight of 410.45 g/mol, XLogP of 7.10, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorodecyl)-3-(3,4,5-trifluorophenyl)benzoic acid is sourced from PubChem (CID 70178502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).