C21H21F5O2 — CID 54294677
2-(2,6-difluorooctan-4-yl)-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 54294677) has the molecular formula C21H21F5O2 and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-(2,6-difluorooctan-4-yl)-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2-(2,6-difluorooctan-4-yl)-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 54294677 |
| Molecular Formula | C21H21F5O2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-(2,6-difluorooctan-4-yl)-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CCC(F)CC(CC(C)F)c1c(C(=O)O)cccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H21F5O2/c1-3-14(23)8-13(7-11(2)22)19-15(5-4-6-16(19)21(27)28)12-9-17(24)20(26)18(25)10-12/h4-6,9-11,13-14H,3,7-8H2,1-2H3,(H,27,28) |
| InChIKey | RZYPEOUCZZARQG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|