C18H38O6 — CID 54454079
2-hydroperoxy-2-(2-hydroperoxy-3,3,5-trimethylhexan-2-yl)peroxy-3,3,5-trimethylhexane (PubChem CID 54454079) has the molecular formula C18H38O6 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2-hydroperoxy-2-(2-hydroperoxy-3,3,5-trimethylhexan-2-yl)peroxy-3,3,5-trimethylhexane.
| Compound Name | 2-hydroperoxy-2-(2-hydroperoxy-3,3,5-trimethylhexan-2-yl)peroxy-3,3,5-trimethylhexane |
|---|---|
| PubChem CID | 54454079 |
| Molecular Formula | C18H38O6 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2-hydroperoxy-2-(2-hydroperoxy-3,3,5-trimethylhexan-2-yl)peroxy-3,3,5-trimethylhexane |
| SMILES | CC(C)CC(C)(C)C(C)(OO)OOC(C)(OO)C(C)(C)CC(C)C |
| InChI | InChI=1S/C18H38O6/c1-13(2)11-15(5,6)17(9,21-19)23-24-18(10,22-20)16(7,8)12-14(3)4/h13-14,19-20H,11-12H2,1-10H3 |
| InChIKey | WWYHLJCPWYNTNU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|