C22H46O — CID 91161387
2,4,4,5,5,6,7,7,8,8,10-undecamethylundecan-2-ol (PubChem CID 91161387) has the molecular formula C22H46O and a molecular weight of 326.61 g/mol. Its IUPAC name is 2,4,4,5,5,6,7,7,8,8,10-undecamethylundecan-2-ol.
| Compound Name | 2,4,4,5,5,6,7,7,8,8,10-undecamethylundecan-2-ol |
|---|---|
| PubChem CID | 91161387 |
| Molecular Formula | C22H46O |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.35 |
| IUPAC Name | 2,4,4,5,5,6,7,7,8,8,10-undecamethylundecan-2-ol |
| SMILES | CC(C)CC(C)(C)C(C)(C)C(C)C(C)(C)C(C)(C)CC(C)(C)O |
| InChI | InChI=1S/C22H46O/c1-16(2)14-18(4,5)21(10,11)17(3)22(12,13)19(6,7)15-20(8,9)23/h16-17,23H,14-15H2,1-13H3 |
| InChIKey | NLRWTPTVIUKAEW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |