C4H10N6 — CID 54455749
2-imino-4,5-dihydropyrimidine-3,4,6-triamine (PubChem CID 54455749) has the molecular formula C4H10N6 and a molecular weight of 142.17 g/mol. Its IUPAC name is 2-imino-4,5-dihydropyrimidine-3,4,6-triamine.
| Compound Name | 2-imino-4,5-dihydropyrimidine-3,4,6-triamine |
|---|---|
| PubChem CID | 54455749 |
| Molecular Formula | C4H10N6 |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-imino-4,5-dihydropyrimidine-3,4,6-triamine |
| SMILES | [H]/N=C1\N=C(N)CC(N)N1N |
| InChI | InChI=1S/C4H10N6/c5-2-1-3(6)10(8)4(7)9-2/h3H,1,6,8H2,(H3,5,7,9) |
| InChIKey | WYBISJTYEYSGLV-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|