C18H22NO7P — CID 54456265
benzyl N-[2-[4-[ethoxy(hydroxy)phosphoryl]oxy-3-hydroxyphenyl]ethyl]carbamate (PubChem CID 54456265) has the molecular formula C18H22NO7P and a molecular weight of 395.35 g/mol. Its IUPAC name is benzyl N-[2-[4-[ethoxy(hydroxy)phosphoryl]oxy-3-hydroxyphenyl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[4-[ethoxy(hydroxy)phosphoryl]oxy-3-hydroxyphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 54456265 |
| Molecular Formula | C18H22NO7P |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | benzyl N-[2-[4-[ethoxy(hydroxy)phosphoryl]oxy-3-hydroxyphenyl]ethyl]carbamate |
| SMILES | CCOP(=O)(O)Oc1ccc(CCNC(=O)OCc2ccccc2)cc1O |
| InChI | InChI=1S/C18H22NO7P/c1-2-25-27(22,23)26-17-9-8-14(12-16(17)20)10-11-19-18(21)24-13-15-6-4-3-5-7-15/h3-9,12,20H,2,10-11,13H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | WYJWTZZTWXIDJC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|