C18H21N3O6 — CID 54457322
4-(N-ethoxy-C-propylcarbonimidoyl)-1-(4-nitrobenzoyl)piperidine-3,5-dione (PubChem CID 54457322) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-(N-ethoxy-C-propylcarbonimidoyl)-1-(4-nitrobenzoyl)piperidine-3,5-dione.
| Compound Name | 4-(N-ethoxy-C-propylcarbonimidoyl)-1-(4-nitrobenzoyl)piperidine-3,5-dione |
|---|---|
| PubChem CID | 54457322 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-(N-ethoxy-C-propylcarbonimidoyl)-1-(4-nitrobenzoyl)piperidine-3,5-dione |
| SMILES | CCCC(=NOCC)C1C(=O)CN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1=O |
| InChI | InChI=1S/C18H21N3O6/c1-3-5-14(19-27-4-2)17-15(22)10-20(11-16(17)23)18(24)12-6-8-13(9-7-12)21(25)26/h6-9,17H,3-5,10-11H2,1-2H3 |
| InChIKey | WZCUZLITHFBUCI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 119.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|