C18H19N4O6- — CID 54457510
5-[5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-3-methylpenta-1,3-dienyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate (PubChem CID 54457510) has the molecular formula C18H19N4O6- and a molecular weight of 387.37 g/mol. Its IUPAC name is 5-[5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-3-methylpenta-1,3-dienyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate.
| Compound Name | 5-[5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-3-methylpenta-1,3-dienyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 54457510 |
| Molecular Formula | C18H19N4O6- |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 5-[5-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)-3-methylpenta-1,3-dienyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
| SMILES | CC(C=Cc1c([O-])n(C)c(=O)n(C)c1=O)=CC=C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C18H20N4O6/c1-10(6-8-11-13(23)19(2)17(27)20(3)14(11)24)7-9-12-15(25)21(4)18(28)22(5)16(12)26/h6-9,23H,1-5H3/p-1 |
| InChIKey | WZGOCAKIFWJOGI-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 124.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|