C25H29N4NaO10 — CID 23553976
sodium 3-butyl-5-[(1E,3E,5Z)-5-[1-butyl-3-(carboxymethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-1-(carboxymethyl)-2,6-dioxopyrimidin-4-olate (PubChem CID 23553976) has the molecular formula C25H29N4NaO10 and a molecular weight of 568.52 g/mol. Its IUPAC name is sodium 3-butyl-5-[(1E,3E,5Z)-5-[1-butyl-3-(carboxymethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-1-(carboxymethyl)-2,6-dioxopyrimidin-4-olate.
| Compound Name | sodium 3-butyl-5-[(1E,3E,5Z)-5-[1-butyl-3-(carboxymethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-1-(carboxymethyl)-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 23553976 |
| Molecular Formula | C25H29N4NaO10 |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | sodium 3-butyl-5-[(1E,3E,5Z)-5-[1-butyl-3-(carboxymethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-1-(carboxymethyl)-2,6-dioxopyrimidin-4-olate |
| SMILES | CCCCN1C(=O)/C(=C/C=C/C=C/c2c([O-])n(CCCC)c(=O)n(CC(=O)O)c2=O)C(=O)N(CC(=O)O)C1=O.[Na+] |
| InChI | InChI=1S/C25H30N4O10.Na/c1-3-5-12-26-20(34)16(22(36)28(24(26)38)14-18(30)31)10-8-7-9-11-17-21(35)27(13-6-4-2)25(39)29(23(17)37)15-19(32)33;/h7-11,34H,3-6,12-15H2,1-2H3,(H,30,31)(H,32,33);/q;+1/p-1/b9-7+,10-8+,17-11-; |
| InChIKey | JGAOLBODGTZJNW-DRSHEVJMSA-M |
| XLogP | -2.86 |
| TPSA | 199.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|