C30H46N4O4S2 — CID 90956861
1,3-dihexyl-5-[3-(1-hexyl-4-hydroxy-3-methyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90956861) has the molecular formula C30H46N4O4S2 and a molecular weight of 590.86 g/mol. Its IUPAC name is 1,3-dihexyl-5-[3-(1-hexyl-4-hydroxy-3-methyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dihexyl-5-[3-(1-hexyl-4-hydroxy-3-methyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90956861 |
| Molecular Formula | C30H46N4O4S2 |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 1,3-dihexyl-5-[3-(1-hexyl-4-hydroxy-3-methyl-6-oxo-2-sulfanylidenepyrimidin-5-yl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCCCCN1C(=O)C(=CC=Cc2c(O)n(C)c(=S)n(CCCCCC)c2=O)C(=O)N(CCCCCC)C1=S |
| InChI | InChI=1S/C30H46N4O4S2/c1-5-8-11-14-20-32-26(36)23(25(35)31(4)29(32)39)18-17-19-24-27(37)33(21-15-12-9-6-2)30(40)34(28(24)38)22-16-13-10-7-3/h17-19,35H,5-16,20-22H2,1-4H3 |
| InChIKey | PKEDRKBYBXVHLF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|