C26H38N4O6 — CID 71030954
5-[5-(1-hexyl-4-hydroxy-3-methyl-2,6-dioxopyrimidin-5-yl)-2,2,5-trimethylhex-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 71030954) has the molecular formula C26H38N4O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is 5-[5-(1-hexyl-4-hydroxy-3-methyl-2,6-dioxopyrimidin-5-yl)-2,2,5-trimethylhex-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[5-(1-hexyl-4-hydroxy-3-methyl-2,6-dioxopyrimidin-5-yl)-2,2,5-trimethylhex-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71030954 |
| Molecular Formula | C26H38N4O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 5-[5-(1-hexyl-4-hydroxy-3-methyl-2,6-dioxopyrimidin-5-yl)-2,2,5-trimethylhex-3-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCn1c(=O)c(C(C)(C)C=CC(C)(C)C=C2C(=O)N(C)C(=O)N(C)C2=O)c(O)n(C)c1=O |
| InChI | InChI=1S/C26H38N4O6/c1-9-10-11-12-15-30-22(34)18(21(33)29(8)24(30)36)26(4,5)14-13-25(2,3)16-17-19(31)27(6)23(35)28(7)20(17)32/h13-14,16,33H,9-12,15H2,1-8H3 |
| InChIKey | VVZARTCDRHDCKU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|