C13H13N4O6- — CID 58825576
5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate (PubChem CID 58825576) has the molecular formula C13H13N4O6- and a molecular weight of 321.27 g/mol. Its IUPAC name is 5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate.
| Compound Name | 5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 58825576 |
| Molecular Formula | C13H13N4O6- |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
| SMILES | CN1C(=O)C(=Cc2c([O-])n(C)c(=O)n(C)c2=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H14N4O6/c1-14-8(18)6(9(19)15(2)12(14)22)5-7-10(20)16(3)13(23)17(4)11(7)21/h5,18H,1-4H3/p-1 |
| InChIKey | OWCWAPPILNWJTL-UHFFFAOYSA-M |
| XLogP | -2.41 |
| TPSA | 124.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|