C4H6N4O3S — CID 54457951
1H-imidazol-2-ylsulfonylurea (PubChem CID 54457951) has the molecular formula C4H6N4O3S and a molecular weight of 190.18 g/mol. Its IUPAC name is 1H-imidazol-2-ylsulfonylurea.
| Compound Name | 1H-imidazol-2-ylsulfonylurea |
|---|---|
| PubChem CID | 54457951 |
| Molecular Formula | C4H6N4O3S |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 1H-imidazol-2-ylsulfonylurea |
| SMILES | NC(=O)NS(=O)(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C4H6N4O3S/c5-3(9)8-12(10,11)4-6-1-2-7-4/h1-2H,(H,6,7)(H3,5,8,9) |
| InChIKey | WZNRLEVJMVACEL-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |