C11H14N4O4S — CID 167825671
ethyl 4-(1H-imidazol-2-ylsulfonylamino)-1-methylpyrrole-3-carboxylate (PubChem CID 167825671) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is ethyl 4-(1H-imidazol-2-ylsulfonylamino)-1-methylpyrrole-3-carboxylate.
| Compound Name | ethyl 4-(1H-imidazol-2-ylsulfonylamino)-1-methylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 167825671 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | ethyl 4-(1H-imidazol-2-ylsulfonylamino)-1-methylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C)cc1NS(=O)(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C11H14N4O4S/c1-3-19-10(16)8-6-15(2)7-9(8)14-20(17,18)11-12-4-5-13-11/h4-7,14H,3H2,1-2H3,(H,12,13) |
| InChIKey | GHUUDBQBGBPKPC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |