C26H29N3O3 — CID 54459122
methyl 3-cyano-2-[2-[cyclohexyl(phenyl)methyl]-4-methoxybenzimidazol-1-yl]propanoate (PubChem CID 54459122) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is methyl 3-cyano-2-[2-[cyclohexyl(phenyl)methyl]-4-methoxybenzimidazol-1-yl]propanoate.
| Compound Name | methyl 3-cyano-2-[2-[cyclohexyl(phenyl)methyl]-4-methoxybenzimidazol-1-yl]propanoate |
|---|---|
| PubChem CID | 54459122 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | methyl 3-cyano-2-[2-[cyclohexyl(phenyl)methyl]-4-methoxybenzimidazol-1-yl]propanoate |
| SMILES | COC(=O)C(CC#N)n1c(C(c2ccccc2)C2CCCCC2)nc2c(OC)cccc21 |
| InChI | InChI=1S/C26H29N3O3/c1-31-22-15-9-14-20-24(22)28-25(29(20)21(16-17-27)26(30)32-2)23(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3,5-6,9-11,14-15,19,21,23H,4,7-8,12-13,16H2,1-2H3 |
| InChIKey | XAISGRGRWGEUNC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |