C20H26O5 — CID 54461449
[2-ethyl-6,7-dimethyl-1-oxo-2-(3-oxobutyl)-3H-inden-5-yl] propaneperoxoate (PubChem CID 54461449) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [2-ethyl-6,7-dimethyl-1-oxo-2-(3-oxobutyl)-3H-inden-5-yl] propaneperoxoate.
| Compound Name | [2-ethyl-6,7-dimethyl-1-oxo-2-(3-oxobutyl)-3H-inden-5-yl] propaneperoxoate |
|---|---|
| PubChem CID | 54461449 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [2-ethyl-6,7-dimethyl-1-oxo-2-(3-oxobutyl)-3H-inden-5-yl] propaneperoxoate |
| SMILES | CCC(=O)OOc1cc2c(c(C)c1C)C(=O)C(CC)(CCC(C)=O)C2 |
| InChI | InChI=1S/C20H26O5/c1-6-17(22)25-24-16-10-15-11-20(7-2,9-8-12(3)21)19(23)18(15)14(5)13(16)4/h10H,6-9,11H2,1-5H3 |
| InChIKey | XBWYBLNHSQGTEI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|