C18H18Cl2O5 — CID 20520905
[6,7-dichloro-1-oxo-2-(3-oxobutyl)-2-prop-2-enyl-3H-inden-5-yl] ethaneperoxoate (PubChem CID 20520905) has the molecular formula C18H18Cl2O5 and a molecular weight of 385.24 g/mol. Its IUPAC name is [6,7-dichloro-1-oxo-2-(3-oxobutyl)-2-prop-2-enyl-3H-inden-5-yl] ethaneperoxoate.
| Compound Name | [6,7-dichloro-1-oxo-2-(3-oxobutyl)-2-prop-2-enyl-3H-inden-5-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 20520905 |
| Molecular Formula | C18H18Cl2O5 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | [6,7-dichloro-1-oxo-2-(3-oxobutyl)-2-prop-2-enyl-3H-inden-5-yl] ethaneperoxoate |
| SMILES | C=CCC1(CCC(C)=O)Cc2cc(OOC(C)=O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C18H18Cl2O5/c1-4-6-18(7-5-10(2)21)9-12-8-13(25-24-11(3)22)15(19)16(20)14(12)17(18)23/h4,8H,1,5-7,9H2,2-3H3 |
| InChIKey | JYQIIFBHEDBYJO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|