C26H36Cl2O4 — CID 155412246
8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanoic acid (PubChem CID 155412246) has the molecular formula C26H36Cl2O4 and a molecular weight of 483.48 g/mol. Its IUPAC name is 8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanoic acid.
| Compound Name | 8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanoic acid |
|---|---|
| PubChem CID | 155412246 |
| Molecular Formula | C26H36Cl2O4 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanoic acid |
| SMILES | CCCCC1(C2CCCC2)Cc2cc(OCCCCCCCC(=O)O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C26H36Cl2O4/c1-2-3-14-26(19-11-8-9-12-19)17-18-16-20(23(27)24(28)22(18)25(26)31)32-15-10-6-4-5-7-13-21(29)30/h16,19H,2-15,17H2,1H3,(H,29,30) |
| InChIKey | UMOFYHONVOBXAC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|