C26H36Cl2O3 — CID 155741408
8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanal (PubChem CID 155741408) has the molecular formula C26H36Cl2O3 and a molecular weight of 467.48 g/mol. Its IUPAC name is 8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanal.
| Compound Name | 8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanal |
|---|---|
| PubChem CID | 155741408 |
| Molecular Formula | C26H36Cl2O3 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 8-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]octanal |
| SMILES | CCCCC1(C2CCCC2)Cc2cc(OCCCCCCCC=O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C26H36Cl2O3/c1-2-3-14-26(20-12-8-9-13-20)18-19-17-21(23(27)24(28)22(19)25(26)30)31-16-11-7-5-4-6-10-15-29/h15,17,20H,2-14,16,18H2,1H3 |
| InChIKey | RQDXAOQMVLVKCL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|