C23H34Cl3NO2 — CID 167618327
2-butyl-6,7-dichloro-2-cyclopentyl-5-[3-(dimethylamino)propoxy]-3H-inden-1-one;hydrochloride (PubChem CID 167618327) has the molecular formula C23H34Cl3NO2 and a molecular weight of 462.89 g/mol. Its IUPAC name is 2-butyl-6,7-dichloro-2-cyclopentyl-5-[3-(dimethylamino)propoxy]-3H-inden-1-one;hydrochloride.
| Compound Name | 2-butyl-6,7-dichloro-2-cyclopentyl-5-[3-(dimethylamino)propoxy]-3H-inden-1-one;hydrochloride |
|---|---|
| PubChem CID | 167618327 |
| Molecular Formula | C23H34Cl3NO2 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-butyl-6,7-dichloro-2-cyclopentyl-5-[3-(dimethylamino)propoxy]-3H-inden-1-one;hydrochloride |
| SMILES | CCCCC1(C2CCCC2)Cc2cc(OCCCN(C)C)c(Cl)c(Cl)c2C1=O.Cl |
| InChI | InChI=1S/C23H33Cl2NO2.ClH/c1-4-5-11-23(17-9-6-7-10-17)15-16-14-18(28-13-8-12-26(2)3)20(24)21(25)19(16)22(23)27;/h14,17H,4-13,15H2,1-3H3;1H |
| InChIKey | CIRTVUAXGBAXLU-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|